C14H9ClF2INO — CID 103766816
N-(4-chloro-2-iodophenyl)-2-(2,4-difluorophenyl)acetamide (PubChem CID 103766816) has the molecular formula C14H9ClF2INO and a molecular weight of 407.59 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-2-(2,4-difluorophenyl)acetamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-2-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 103766816 |
| Molecular Formula | C14H9ClF2INO |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-2-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1F)Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C14H9ClF2INO/c15-9-2-4-13(12(18)6-9)19-14(20)5-8-1-3-10(16)7-11(8)17/h1-4,6-7H,5H2,(H,19,20) |
| InChIKey | PJSZPDOYJRNFJS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|