C8H7NO5 — CID 154478317
2-(2,5-dihydroxyanilino)-2-oxoacetic acid (PubChem CID 154478317) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is 2-(2,5-dihydroxyanilino)-2-oxoacetic acid.
| Compound Name | 2-(2,5-dihydroxyanilino)-2-oxoacetic acid |
|---|---|
| PubChem CID | 154478317 |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-(2,5-dihydroxyanilino)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1cc(O)ccc1O |
| InChI | InChI=1S/C8H7NO5/c10-4-1-2-6(11)5(3-4)9-7(12)8(13)14/h1-3,10-11H,(H,9,12)(H,13,14) |
| InChIKey | FECIYZXCGLKNFM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|