C20H30N2O3 — CID 122660194
2-cyclohexyl-2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide (PubChem CID 122660194) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-cyclohexyl-2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide.
| Compound Name | 2-cyclohexyl-2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 122660194 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-cyclohexyl-2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide |
| SMILES | O=C(Nc1cc(O)ccc1O)C(NC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O3/c23-16-11-12-18(24)17(13-16)22-20(25)19(14-7-3-1-4-8-14)21-15-9-5-2-6-10-15/h11-15,19,21,23-24H,1-10H2,(H,22,25) |
| InChIKey | UNPNYXYMVMWNQB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|