C21H28BrClN2O3 — CID 21343966
N-[4-[(2-bromo-2-cyclohexylacetyl)amino]-5-chloro-2-hydroxyphenyl]cyclohexanecarboxamide (PubChem CID 21343966) has the molecular formula C21H28BrClN2O3 and a molecular weight of 471.82 g/mol. Its IUPAC name is N-[4-[(2-bromo-2-cyclohexylacetyl)amino]-5-chloro-2-hydroxyphenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[(2-bromo-2-cyclohexylacetyl)amino]-5-chloro-2-hydroxyphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 21343966 |
| Molecular Formula | C21H28BrClN2O3 |
| Molecular Weight | 471.82 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[4-[(2-bromo-2-cyclohexylacetyl)amino]-5-chloro-2-hydroxyphenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cc(Cl)c(NC(=O)C(Br)C2CCCCC2)cc1O)C1CCCCC1 |
| InChI | InChI=1S/C21H28BrClN2O3/c22-19(13-7-3-1-4-8-13)21(28)24-16-12-18(26)17(11-15(16)23)25-20(27)14-9-5-2-6-10-14/h11-14,19,26H,1-10H2,(H,24,28)(H,25,27) |
| InChIKey | PSTQFEDGLOUFFM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.82 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|