C23H29N3O4 — CID 134111443
methyl 3-[[N-cyclohexyl-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]amino]-4-hydroxybenzoate (PubChem CID 134111443) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl 3-[[N-cyclohexyl-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]amino]-4-hydroxybenzoate.
| Compound Name | methyl 3-[[N-cyclohexyl-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]amino]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 134111443 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | methyl 3-[[N-cyclohexyl-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]amino]-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(N/C(=N/CCc2ccc(O)cc2)NC2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O4/c1-30-22(29)17-9-12-21(28)20(15-17)26-23(25-18-5-3-2-4-6-18)24-14-13-16-7-10-19(27)11-8-16/h7-12,15,18,27-28H,2-6,13-14H2,1H3,(H2,24,25,26) |
| InChIKey | DWHFMCDZGCCDTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|