C18H27N3O3 — CID 134111433
methyl 3-[(N'-cyclohexyl-N-propan-2-ylcarbamimidoyl)amino]-4-hydroxybenzoate (PubChem CID 134111433) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl 3-[(N'-cyclohexyl-N-propan-2-ylcarbamimidoyl)amino]-4-hydroxybenzoate.
| Compound Name | methyl 3-[(N'-cyclohexyl-N-propan-2-ylcarbamimidoyl)amino]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 134111433 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | methyl 3-[(N'-cyclohexyl-N-propan-2-ylcarbamimidoyl)amino]-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(N/C(=N/C2CCCCC2)NC(C)C)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-12(2)19-18(20-14-7-5-4-6-8-14)21-15-11-13(17(23)24-3)9-10-16(15)22/h9-12,14,22H,4-8H2,1-3H3,(H2,19,20,21) |
| InChIKey | VYXJICMYPHWTNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|