C21H25N3O4S — CID 10409601
methyl 2-[[N-(benzenesulfonyl)-N'-cyclohexylcarbamimidoyl]amino]benzoate (PubChem CID 10409601) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is methyl 2-[[N-(benzenesulfonyl)-N'-cyclohexylcarbamimidoyl]amino]benzoate.
| Compound Name | methyl 2-[[N-(benzenesulfonyl)-N'-cyclohexylcarbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 10409601 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | methyl 2-[[N-(benzenesulfonyl)-N'-cyclohexylcarbamimidoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C(=N/C1CCCCC1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-28-20(25)18-14-8-9-15-19(18)23-21(22-16-10-4-2-5-11-16)24-29(26,27)17-12-6-3-7-13-17/h3,6-9,12-16H,2,4-5,10-11H2,1H3,(H2,22,23,24) |
| InChIKey | SRHMIYDWGRNHLS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|