C15H23N3O2S — CID 46379193
2-cycloheptyl-1-methylsulfonyl-3-phenylguanidine (PubChem CID 46379193) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-cycloheptyl-1-methylsulfonyl-3-phenylguanidine.
| Compound Name | 2-cycloheptyl-1-methylsulfonyl-3-phenylguanidine |
|---|---|
| PubChem CID | 46379193 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-cycloheptyl-1-methylsulfonyl-3-phenylguanidine |
| SMILES | CS(=O)(=O)N/C(=N/C1CCCCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C15H23N3O2S/c1-21(19,20)18-15(17-14-11-7-4-8-12-14)16-13-9-5-2-3-6-10-13/h4,7-8,11-13H,2-3,5-6,9-10H2,1H3,(H2,16,17,18) |
| InChIKey | DTMFHPHFWPCJBX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|