C15H22N4O3S — CID 163987430
N-[4-[(N'-cyclohexylcarbamimidoyl)sulfamoyl]phenyl]acetamide (PubChem CID 163987430) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[4-[(N'-cyclohexylcarbamimidoyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(N'-cyclohexylcarbamimidoyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 163987430 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[4-[(N'-cyclohexylcarbamimidoyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N/C(N)=N/C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H22N4O3S/c1-11(20)17-13-7-9-14(10-8-13)23(21,22)19-15(16)18-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,17,20)(H3,16,18,19) |
| InChIKey | TXOZOSNONGVLBY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|