C14H21N3O2S2 — CID 10381802
methyl N-(4-aminophenyl)sulfonyl-N'-cyclohexylcarbamimidothioate (PubChem CID 10381802) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is methyl N-(4-aminophenyl)sulfonyl-N'-cyclohexylcarbamimidothioate.
| Compound Name | methyl N-(4-aminophenyl)sulfonyl-N'-cyclohexylcarbamimidothioate |
|---|---|
| PubChem CID | 10381802 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl N-(4-aminophenyl)sulfonyl-N'-cyclohexylcarbamimidothioate |
| SMILES | CS/C(=N\C1CCCCC1)NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-20-14(16-12-5-3-2-4-6-12)17-21(18,19)13-9-7-11(15)8-10-13/h7-10,12H,2-6,15H2,1H3,(H,16,17) |
| InChIKey | FLVPPHWGKZIIMH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|