About methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate
methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate (PubChem CID 150391369) has the molecular formula C22H36N2S
and a molecular weight of 360.61 g/mol. Its IUPAC name is methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate |
| PubChem CID | 150391369 |
| Molecular Formula | C22H36N2S |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\C1CCCC1)Nc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H36N2S/c1-14(2)17-12-19(15(3)4)21(20(13-17)16(5)6)24-22(25-7)23-18-10-8-9-11-18/h12-16,18H,8-11H2,1-7H3,(H,23,24) |
| InChIKey | HBTWGZZTPZXFKT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate?
The IUPAC name of methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate (CID 150391369) is methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate.
What is the SMILES notation for methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate?
The canonical SMILES for methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate is CS/C(=N\C1CCCC1)Nc1c(C(C)C)cc(C(C)C)cc1C(C)C.
What is the InChIKey of methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate?
The InChIKey is HBTWGZZTPZXFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2S/c1-14(2)17-12-19(15(3)4)21(20(13-17)16(5)6)24-22(25-7)23-18-10-8-9-11-18/h12-16,18H,8-11H2,1-7H3,(H,23,24).
What are the key properties of methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate?
methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate has a molecular weight of 360.61 g/mol, XLogP of 7.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-cyclopentyl-N-[2,4,6-tri(propan-2-yl)phenyl]carbamimidothioate is sourced from PubChem (CID 150391369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).