C25H40S — CID 10571365
1,3,5-tri(propan-2-yl)-2-[[(1S,2S)-2-prop-1-en-2-ylcyclohexyl]methylsulfanyl]benzene (PubChem CID 10571365) has the molecular formula C25H40S and a molecular weight of 372.66 g/mol. Its IUPAC name is 1,3,5-tri(propan-2-yl)-2-[[(1S,2S)-2-prop-1-en-2-ylcyclohexyl]methylsulfanyl]benzene.
| Compound Name | 1,3,5-tri(propan-2-yl)-2-[[(1S,2S)-2-prop-1-en-2-ylcyclohexyl]methylsulfanyl]benzene |
|---|---|
| PubChem CID | 10571365 |
| Molecular Formula | C25H40S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1,3,5-tri(propan-2-yl)-2-[[(1S,2S)-2-prop-1-en-2-ylcyclohexyl]methylsulfanyl]benzene |
| SMILES | C=C(C)[C@H]1CCCC[C@@H]1CSc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H40S/c1-16(2)21-13-23(18(5)6)25(24(14-21)19(7)8)26-15-20-11-9-10-12-22(20)17(3)4/h13-14,16,18-20,22H,3,9-12,15H2,1-2,4-8H3/t20-,22-/m1/s1 |
| InChIKey | XJFGTAPNSQZDIY-IFMALSPDSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|