C27H34N2 — CID 122216334
N'-cyclohexyl-N-[2,6-di(propan-2-yl)phenyl]-3-phenylprop-2-ynimidamide (PubChem CID 122216334) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is N'-cyclohexyl-N-[2,6-di(propan-2-yl)phenyl]-3-phenylprop-2-ynimidamide.
| Compound Name | N'-cyclohexyl-N-[2,6-di(propan-2-yl)phenyl]-3-phenylprop-2-ynimidamide |
|---|---|
| PubChem CID | 122216334 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N'-cyclohexyl-N-[2,6-di(propan-2-yl)phenyl]-3-phenylprop-2-ynimidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N/C(C#Cc1ccccc1)=N/C1CCCCC1 |
| InChI | InChI=1S/C27H34N2/c1-20(2)24-16-11-17-25(21(3)4)27(24)29-26(28-23-14-9-6-10-15-23)19-18-22-12-7-5-8-13-22/h5,7-8,11-13,16-17,20-21,23H,6,9-10,14-15H2,1-4H3,(H,28,29) |
| InChIKey | CKRPUMAPMALREB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|