C31H52N2 — CID 58114908
N'-[(6S)-2,6-di(propan-2-yl)cyclohexyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboximidamide (PubChem CID 58114908) has the molecular formula C31H52N2 and a molecular weight of 452.77 g/mol. Its IUPAC name is N'-[(6S)-2,6-di(propan-2-yl)cyclohexyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboximidamide.
| Compound Name | N'-[(6S)-2,6-di(propan-2-yl)cyclohexyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboximidamide |
|---|---|
| PubChem CID | 58114908 |
| Molecular Formula | C31H52N2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.41 |
| IUPAC Name | N'-[(6S)-2,6-di(propan-2-yl)cyclohexyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboximidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N/C(=N/C1C(C(C)C)CCC[C@H]1C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H52N2/c1-20(2)25-16-12-17-26(21(3)4)29(25)32-31(24-14-10-9-11-15-24)33-30-27(22(5)6)18-13-19-28(30)23(7)8/h12,16-17,20-24,27-28,30H,9-11,13-15,18-19H2,1-8H3,(H,32,33)/t27-,28?,30?/m0/s1 |
| InChIKey | GXCXBHWRNUOBEG-PNBLDXKVSA-N |
| XLogP | 9.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|