C19H30N2S — CID 87849745
1-cyclohexyl-3-(2-ethyl-6-propan-2-ylphenyl)-1-methylthiourea (PubChem CID 87849745) has the molecular formula C19H30N2S and a molecular weight of 318.53 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-ethyl-6-propan-2-ylphenyl)-1-methylthiourea.
| Compound Name | 1-cyclohexyl-3-(2-ethyl-6-propan-2-ylphenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 87849745 |
| Molecular Formula | C19H30N2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-cyclohexyl-3-(2-ethyl-6-propan-2-ylphenyl)-1-methylthiourea |
| SMILES | CCc1cccc(C(C)C)c1NC(=S)N(C)C1CCCCC1 |
| InChI | InChI=1S/C19H30N2S/c1-5-15-10-9-13-17(14(2)3)18(15)20-19(22)21(4)16-11-7-6-8-12-16/h9-10,13-14,16H,5-8,11-12H2,1-4H3,(H,20,22) |
| InChIKey | PLUHHRFRADYERC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|