C16H26N2S — CID 169359447
[2,4,6-tri(propan-2-yl)phenyl]thiourea (PubChem CID 169359447) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is [2,4,6-tri(propan-2-yl)phenyl]thiourea.
| Compound Name | [2,4,6-tri(propan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169359447 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [2,4,6-tri(propan-2-yl)phenyl]thiourea |
| SMILES | CC(C)c1cc(C(C)C)c(NC(N)=S)c(C(C)C)c1 |
| InChI | InChI=1S/C16H26N2S/c1-9(2)12-7-13(10(3)4)15(18-16(17)19)14(8-12)11(5)6/h7-11H,1-6H3,(H3,17,18,19) |
| InChIKey | RHWIVHDMQQKURF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|