C16H28Br2N4S2 — CID 86645725
[5-[(carbamothioylamino)methyl]-2,4-di(propan-2-yl)phenyl]methylthiourea;dihydrobromide (PubChem CID 86645725) has the molecular formula C16H28Br2N4S2 and a molecular weight of 500.37 g/mol. Its IUPAC name is [5-[(carbamothioylamino)methyl]-2,4-di(propan-2-yl)phenyl]methylthiourea;dihydrobromide.
| Compound Name | [5-[(carbamothioylamino)methyl]-2,4-di(propan-2-yl)phenyl]methylthiourea;dihydrobromide |
|---|---|
| PubChem CID | 86645725 |
| Molecular Formula | C16H28Br2N4S2 |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | [5-[(carbamothioylamino)methyl]-2,4-di(propan-2-yl)phenyl]methylthiourea;dihydrobromide |
| SMILES | Br.Br.CC(C)c1cc(C(C)C)c(CNC(N)=S)cc1CNC(N)=S |
| InChI | InChI=1S/C16H26N4S2.2BrH/c1-9(2)13-6-14(10(3)4)12(8-20-16(18)22)5-11(13)7-19-15(17)21;;/h5-6,9-10H,7-8H2,1-4H3,(H3,17,19,21)(H3,18,20,22);2*1H |
| InChIKey | OBRBLQONNXZXGB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|