C8H9BrF2N2S — CID 173140070
(2,6-difluorophenyl)methylthiourea;hydrobromide (PubChem CID 173140070) has the molecular formula C8H9BrF2N2S and a molecular weight of 283.14 g/mol. Its IUPAC name is (2,6-difluorophenyl)methylthiourea;hydrobromide.
| Compound Name | (2,6-difluorophenyl)methylthiourea;hydrobromide |
|---|---|
| PubChem CID | 173140070 |
| Molecular Formula | C8H9BrF2N2S |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | (2,6-difluorophenyl)methylthiourea;hydrobromide |
| SMILES | Br.NC(=S)NCc1c(F)cccc1F |
| InChI | InChI=1S/C8H8F2N2S.BrH/c9-6-2-1-3-7(10)5(6)4-12-8(11)13;/h1-3H,4H2,(H3,11,12,13);1H |
| InChIKey | OGDYTLVGGYELRK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|