C7H6ClF2N — CID 126658076
N-chloro-1-(2,6-difluorophenyl)methanamine (PubChem CID 126658076) has the molecular formula C7H6ClF2N and a molecular weight of 177.58 g/mol. Its IUPAC name is N-chloro-1-(2,6-difluorophenyl)methanamine.
| Compound Name | N-chloro-1-(2,6-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 126658076 |
| Molecular Formula | C7H6ClF2N |
| Molecular Weight | 177.58 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | N-chloro-1-(2,6-difluorophenyl)methanamine |
| SMILES | Fc1cccc(F)c1CNCl |
| InChI | InChI=1S/C7H6ClF2N/c8-11-4-5-6(9)2-1-3-7(5)10/h1-3,11H,4H2 |
| InChIKey | FLUUIKUCFXLREM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|