C12H16ClF2N — CID 114934231
4-chloro-N-[(2,6-difluorophenyl)methyl]-2-methylbutan-2-amine (PubChem CID 114934231) has the molecular formula C12H16ClF2N and a molecular weight of 247.72 g/mol. Its IUPAC name is 4-chloro-N-[(2,6-difluorophenyl)methyl]-2-methylbutan-2-amine.
| Compound Name | 4-chloro-N-[(2,6-difluorophenyl)methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 114934231 |
| Molecular Formula | C12H16ClF2N |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 4-chloro-N-[(2,6-difluorophenyl)methyl]-2-methylbutan-2-amine |
| SMILES | CC(C)(CCCl)NCc1c(F)cccc1F |
| InChI | InChI=1S/C12H16ClF2N/c1-12(2,6-7-13)16-8-9-10(14)4-3-5-11(9)15/h3-5,16H,6-8H2,1-2H3 |
| InChIKey | PDSKXKRAQKVXLR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|