C7H5ClF2O — CID 70312638
(2,6-difluorophenyl)methyl hypochlorite (PubChem CID 70312638) has the molecular formula C7H5ClF2O and a molecular weight of 178.57 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl hypochlorite.
| Compound Name | (2,6-difluorophenyl)methyl hypochlorite |
|---|---|
| PubChem CID | 70312638 |
| Molecular Formula | C7H5ClF2O |
| Molecular Weight | 178.57 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | (2,6-difluorophenyl)methyl hypochlorite |
| SMILES | Fc1cccc(F)c1COCl |
| InChI | InChI=1S/C7H5ClF2O/c8-11-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | HSVXMPQJYUWLJK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |