C13H20F2O3Si — CID 146004962
(2,6-difluorophenyl)methyl-triethoxysilane (PubChem CID 146004962) has the molecular formula C13H20F2O3Si and a molecular weight of 290.38 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl-triethoxysilane.
| Compound Name | (2,6-difluorophenyl)methyl-triethoxysilane |
|---|---|
| PubChem CID | 146004962 |
| Molecular Formula | C13H20F2O3Si |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (2,6-difluorophenyl)methyl-triethoxysilane |
| SMILES | CCO[Si](Cc1c(F)cccc1F)(OCC)OCC |
| InChI | InChI=1S/C13H20F2O3Si/c1-4-16-19(17-5-2,18-6-3)10-11-12(14)8-7-9-13(11)15/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | LFMGWFDGUVOYLV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|