About benzyl(triethoxy)silane;propan-2-ol
benzyl(triethoxy)silane;propan-2-ol (PubChem CID 172724025) has the molecular formula C16H30O4Si
and a molecular weight of 314.50 g/mol. Its IUPAC name is benzyl(triethoxy)silane;propan-2-ol.
Molecular Properties
| Compound Name | benzyl(triethoxy)silane;propan-2-ol |
| PubChem CID | 172724025 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | benzyl(triethoxy)silane;propan-2-ol |
| SMILES | CC(C)O.CCO[Si](Cc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C13H22O3Si.C3H8O/c1-4-14-17(15-5-2,16-6-3)12-13-10-8-7-9-11-13;1-3(2)4/h7-11H,4-6,12H2,1-3H3;3-4H,1-2H3 |
| InChIKey | GWZVLYBUHCUESD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethoxy)silane;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethoxy)silane;propan-2-ol?
The IUPAC name of benzyl(triethoxy)silane;propan-2-ol (CID 172724025) is benzyl(triethoxy)silane;propan-2-ol.
What is the SMILES notation for benzyl(triethoxy)silane;propan-2-ol?
The canonical SMILES for benzyl(triethoxy)silane;propan-2-ol is CC(C)O.CCO[Si](Cc1ccccc1)(OCC)OCC.
What is the InChIKey of benzyl(triethoxy)silane;propan-2-ol?
The InChIKey is GWZVLYBUHCUESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3Si.C3H8O/c1-4-14-17(15-5-2,16-6-3)12-13-10-8-7-9-11-13;1-3(2)4/h7-11H,4-6,12H2,1-3H3;3-4H,1-2H3.
What are the key properties of benzyl(triethoxy)silane;propan-2-ol?
benzyl(triethoxy)silane;propan-2-ol has a molecular weight of 314.50 g/mol, XLogP of 3.20, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethoxy)silane;propan-2-ol is sourced from PubChem (CID 172724025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).