C17H29NO4Si — CID 175314964
4-[diethoxy(1-phenylpropan-2-yloxy)silyl]butanamide (PubChem CID 175314964) has the molecular formula C17H29NO4Si and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-[diethoxy(1-phenylpropan-2-yloxy)silyl]butanamide.
| Compound Name | 4-[diethoxy(1-phenylpropan-2-yloxy)silyl]butanamide |
|---|---|
| PubChem CID | 175314964 |
| Molecular Formula | C17H29NO4Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-[diethoxy(1-phenylpropan-2-yloxy)silyl]butanamide |
| SMILES | CCO[Si](CCCC(N)=O)(OCC)OC(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H29NO4Si/c1-4-20-23(21-5-2,13-9-12-17(18)19)22-15(3)14-16-10-7-6-8-11-16/h6-8,10-11,15H,4-5,9,12-14H2,1-3H3,(H2,18,19) |
| InChIKey | GQJRYZTXIIPNGD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|