C21H29N3O4 — CID 160831000
[(2R)-2-amino-3-phenylpropyl] acetate;[(2S)-2-amino-3-phenylpropyl] carbamate (PubChem CID 160831000) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [(2R)-2-amino-3-phenylpropyl] acetate;[(2S)-2-amino-3-phenylpropyl] carbamate.
| Compound Name | [(2R)-2-amino-3-phenylpropyl] acetate;[(2S)-2-amino-3-phenylpropyl] carbamate |
|---|---|
| PubChem CID | 160831000 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [(2R)-2-amino-3-phenylpropyl] acetate;[(2S)-2-amino-3-phenylpropyl] carbamate |
| SMILES | CC(=O)OC[C@H](N)Cc1ccccc1.NC(=O)OC[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C10H14N2O2/c1-9(13)14-8-11(12)7-10-5-3-2-4-6-10;11-9(7-14-10(12)13)6-8-4-2-1-3-5-8/h2-6,11H,7-8,12H2,1H3;1-5,9H,6-7,11H2,(H2,12,13)/t11-;9-/m10/s1 |
| InChIKey | SGUJRWJSPXPIBS-AXNAYKSSSA-N |
| XLogP | 1.77 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |