C14H20N2O8 — CID 175923615
(2-amino-3-phenylpropyl) carbamate;2,3-dihydroxybutanedioic acid (PubChem CID 175923615) has the molecular formula C14H20N2O8 and a molecular weight of 344.32 g/mol. Its IUPAC name is (2-amino-3-phenylpropyl) carbamate;2,3-dihydroxybutanedioic acid.
| Compound Name | (2-amino-3-phenylpropyl) carbamate;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 175923615 |
| Molecular Formula | C14H20N2O8 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2-amino-3-phenylpropyl) carbamate;2,3-dihydroxybutanedioic acid |
| SMILES | NC(=O)OCC(N)Cc1ccccc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H14N2O2.C4H6O6/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8;5-1(3(7)8)2(6)4(9)10/h1-5,9H,6-7,11H2,(H2,12,13);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | QNGUARQHWKNMRQ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |