C9H12F2S — CID 178170499
(2,6-difluorophenyl)methanethiol;ethane (PubChem CID 178170499) has the molecular formula C9H12F2S and a molecular weight of 190.26 g/mol. Its IUPAC name is (2,6-difluorophenyl)methanethiol;ethane.
| Compound Name | (2,6-difluorophenyl)methanethiol;ethane |
|---|---|
| PubChem CID | 178170499 |
| Molecular Formula | C9H12F2S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2,6-difluorophenyl)methanethiol;ethane |
| SMILES | CC.Fc1cccc(F)c1CS |
| InChI | InChI=1S/C7H6F2S.C2H6/c8-6-2-1-3-7(9)5(6)4-10;1-2/h1-3,10H,4H2;1-2H3 |
| InChIKey | CUUOVIBFWZVDPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|