C9H9BrF2 — CID 178142068
2-(bromomethyl)-1,3-difluorobenzene;ethene (PubChem CID 178142068) has the molecular formula C9H9BrF2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-difluorobenzene;ethene.
| Compound Name | 2-(bromomethyl)-1,3-difluorobenzene;ethene |
|---|---|
| PubChem CID | 178142068 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-(bromomethyl)-1,3-difluorobenzene;ethene |
| SMILES | C=C.Fc1cccc(F)c1CBr |
| InChI | InChI=1S/C7H5BrF2.C2H4/c8-4-5-6(9)2-1-3-7(5)10;1-2/h1-3H,4H2;1-2H2 |
| InChIKey | RVTMHNKOSLAHSR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|