C13H8BrCl2F — CID 134619388
2-(bromomethyl)-1-(2,6-dichlorophenyl)-3-fluorobenzene (PubChem CID 134619388) has the molecular formula C13H8BrCl2F and a molecular weight of 334.02 g/mol. Its IUPAC name is 2-(bromomethyl)-1-(2,6-dichlorophenyl)-3-fluorobenzene.
| Compound Name | 2-(bromomethyl)-1-(2,6-dichlorophenyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 134619388 |
| Molecular Formula | C13H8BrCl2F |
| Molecular Weight | 334.02 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 2-(bromomethyl)-1-(2,6-dichlorophenyl)-3-fluorobenzene |
| SMILES | Fc1cccc(-c2c(Cl)cccc2Cl)c1CBr |
| InChI | InChI=1S/C13H8BrCl2F/c14-7-9-8(3-1-6-12(9)17)13-10(15)4-2-5-11(13)16/h1-6H,7H2 |
| InChIKey | OEQYYLKFZKEBJS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.02 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|