C13H5BrCl6 — CID 134617199
1-[2-(bromomethyl)-3-chlorophenyl]-2,3,4,5,6-pentachlorobenzene (PubChem CID 134617199) has the molecular formula C13H5BrCl6 and a molecular weight of 453.81 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-chlorophenyl]-2,3,4,5,6-pentachlorobenzene.
| Compound Name | 1-[2-(bromomethyl)-3-chlorophenyl]-2,3,4,5,6-pentachlorobenzene |
|---|---|
| PubChem CID | 134617199 |
| Molecular Formula | C13H5BrCl6 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 449.77 |
| IUPAC Name | 1-[2-(bromomethyl)-3-chlorophenyl]-2,3,4,5,6-pentachlorobenzene |
| SMILES | Clc1cccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1CBr |
| InChI | InChI=1S/C13H5BrCl6/c14-4-6-5(2-1-3-7(6)15)8-9(16)11(18)13(20)12(19)10(8)17/h1-3H,4H2 |
| InChIKey | GVFCPBUJCZAGGM-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|