C12H6Cl6O2 — CID 138395099
2,3,5,6-tetrachloro-4-(2,3-dichlorophenyl)phenol;hydrate (PubChem CID 138395099) has the molecular formula C12H6Cl6O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-4-(2,3-dichlorophenyl)phenol;hydrate.
| Compound Name | 2,3,5,6-tetrachloro-4-(2,3-dichlorophenyl)phenol;hydrate |
|---|---|
| PubChem CID | 138395099 |
| Molecular Formula | C12H6Cl6O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 391.85 |
| IUPAC Name | 2,3,5,6-tetrachloro-4-(2,3-dichlorophenyl)phenol;hydrate |
| SMILES | O.Oc1c(Cl)c(Cl)c(-c2cccc(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl6O.H2O/c13-5-3-1-2-4(7(5)14)6-8(15)10(17)12(19)11(18)9(6)16;/h1-3,19H;1H2 |
| InChIKey | MWEJLRPHDAOKMU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|