C12H4Cl2F4 — CID 118803913
3-(2,3-dichlorophenyl)-1,2,4,5-tetrafluorobenzene (PubChem CID 118803913) has the molecular formula C12H4Cl2F4 and a molecular weight of 295.06 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-(2,3-dichlorophenyl)-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 118803913 |
| Molecular Formula | C12H4Cl2F4 |
| Molecular Weight | 295.06 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1,2,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(F)c(F)c(-c2cccc(Cl)c2Cl)c1F |
| InChI | InChI=1S/C12H4Cl2F4/c13-6-3-1-2-5(10(6)14)9-11(17)7(15)4-8(16)12(9)18/h1-4H |
| InChIKey | JKNOFSWQQYEBMY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|