C17H8Cl4FN — CID 133090739
3,5-bis(2,3-dichlorophenyl)-4-fluoropyridine (PubChem CID 133090739) has the molecular formula C17H8Cl4FN and a molecular weight of 387.07 g/mol. Its IUPAC name is 3,5-bis(2,3-dichlorophenyl)-4-fluoropyridine.
| Compound Name | 3,5-bis(2,3-dichlorophenyl)-4-fluoropyridine |
|---|---|
| PubChem CID | 133090739 |
| Molecular Formula | C17H8Cl4FN |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 3,5-bis(2,3-dichlorophenyl)-4-fluoropyridine |
| SMILES | Fc1c(-c2cccc(Cl)c2Cl)cncc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H8Cl4FN/c18-13-5-1-3-9(15(13)20)11-7-23-8-12(17(11)22)10-4-2-6-14(19)16(10)21/h1-8H |
| InChIKey | HKVVBMHWEJYILY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |