C11H5Cl2F2N — CID 133090714
3-(2,3-dichlorophenyl)-2,5-difluoropyridine (PubChem CID 133090714) has the molecular formula C11H5Cl2F2N and a molecular weight of 260.07 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2,5-difluoropyridine.
| Compound Name | 3-(2,3-dichlorophenyl)-2,5-difluoropyridine |
|---|---|
| PubChem CID | 133090714 |
| Molecular Formula | C11H5Cl2F2N |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-2,5-difluoropyridine |
| SMILES | Fc1cnc(F)c(-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C11H5Cl2F2N/c12-9-3-1-2-7(10(9)13)8-4-6(14)5-16-11(8)15/h1-5H |
| InChIKey | XHCOERILODZBQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|