C17H6Cl6FN — CID 134637089
5-fluoro-2,3-bis(2,3,6-trichlorophenyl)pyridine (PubChem CID 134637089) has the molecular formula C17H6Cl6FN and a molecular weight of 455.96 g/mol. Its IUPAC name is 5-fluoro-2,3-bis(2,3,6-trichlorophenyl)pyridine.
| Compound Name | 5-fluoro-2,3-bis(2,3,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134637089 |
| Molecular Formula | C17H6Cl6FN |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 452.86 |
| IUPAC Name | 5-fluoro-2,3-bis(2,3,6-trichlorophenyl)pyridine |
| SMILES | Fc1cnc(-c2c(Cl)ccc(Cl)c2Cl)c(-c2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H6Cl6FN/c18-9-1-3-11(20)15(22)13(9)8-5-7(24)6-25-17(8)14-10(19)2-4-12(21)16(14)23/h1-6H |
| InChIKey | SUBGAXWLSNMVIA-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|