C17H6Cl7N — CID 134637033
5-chloro-2,3-bis(2,3,6-trichlorophenyl)pyridine (PubChem CID 134637033) has the molecular formula C17H6Cl7N and a molecular weight of 472.41 g/mol. Its IUPAC name is 5-chloro-2,3-bis(2,3,6-trichlorophenyl)pyridine.
| Compound Name | 5-chloro-2,3-bis(2,3,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134637033 |
| Molecular Formula | C17H6Cl7N |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 468.83 |
| IUPAC Name | 5-chloro-2,3-bis(2,3,6-trichlorophenyl)pyridine |
| SMILES | Clc1cnc(-c2c(Cl)ccc(Cl)c2Cl)c(-c2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H6Cl7N/c18-7-5-8(13-9(19)1-3-11(21)15(13)23)17(25-6-7)14-10(20)2-4-12(22)16(14)24/h1-6H |
| InChIKey | VQGNGGFLZTYMNX-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|