C18H6Cl6F3NO — CID 133092515
2,4-bis(2,3,6-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-ol (PubChem CID 133092515) has the molecular formula C18H6Cl6F3NO and a molecular weight of 521.96 g/mol. Its IUPAC name is 2,4-bis(2,3,6-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-ol.
| Compound Name | 2,4-bis(2,3,6-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 133092515 |
| Molecular Formula | C18H6Cl6F3NO |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 518.85 |
| IUPAC Name | 2,4-bis(2,3,6-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-ol |
| SMILES | Oc1c(-c2c(Cl)ccc(Cl)c2Cl)cc(C(F)(F)F)nc1-c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C18H6Cl6F3NO/c19-7-1-3-9(21)14(23)12(7)6-5-11(18(25,26)27)28-16(17(6)29)13-8(20)2-4-10(22)15(13)24/h1-5,29H |
| InChIKey | OZKYHMYJNQIJMK-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|