C24HCl15F3N — CID 134630482
2,3,4-tris(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine (PubChem CID 134630482) has the molecular formula C24HCl15F3N and a molecular weight of 892.07 g/mol. Its IUPAC name is 2,3,4-tris(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine.
| Compound Name | 2,3,4-tris(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134630482 |
| Molecular Formula | C24HCl15F3N |
| Molecular Weight | 892.07 g/mol |
| Exact Mass | 884.54 |
| IUPAC Name | 2,3,4-tris(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C24HCl15F3N/c25-8-5(9(26)15(32)20(37)14(8)31)2-1-3(24(40,41)42)43-23(7-12(29)18(35)22(39)19(36)13(7)30)4(2)6-10(27)16(33)21(38)17(34)11(6)28/h1H |
| InChIKey | DOJFKNDCPKPTIJ-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.07 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|