C18H7Cl6F3N2 — CID 133086465
2,4-bis(2,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 133086465) has the molecular formula C18H7Cl6F3N2 and a molecular weight of 520.98 g/mol. Its IUPAC name is 2,4-bis(2,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 2,4-bis(2,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133086465 |
| Molecular Formula | C18H7Cl6F3N2 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 517.87 |
| IUPAC Name | 2,4-bis(2,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1c(-c2cc(Cl)c(Cl)cc2Cl)cc(C(F)(F)F)nc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H7Cl6F3N2/c19-9-4-13(23)11(21)1-6(9)7-3-15(18(25,26)27)29-17(16(7)28)8-2-12(22)14(24)5-10(8)20/h1-5H,28H2 |
| InChIKey | YIRJKGYIFKJFLC-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|