C18H6Cl6F3N — CID 134618234
2,6-bis(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine (PubChem CID 134618234) has the molecular formula C18H6Cl6F3N and a molecular weight of 505.97 g/mol. Its IUPAC name is 2,6-bis(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine.
| Compound Name | 2,6-bis(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134618234 |
| Molecular Formula | C18H6Cl6F3N |
| Molecular Weight | 505.97 g/mol |
| Exact Mass | 502.86 |
| IUPAC Name | 2,6-bis(2,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc(Cl)c(Cl)cc2Cl)nc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H6Cl6F3N/c19-10-5-14(23)12(21)3-7(10)16-2-1-9(18(25,26)27)17(28-16)8-4-13(22)15(24)6-11(8)20/h1-6H |
| InChIKey | LTKUMTYAFJRPGZ-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.97 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|