C12H9Cl3N2 — CID 133086502
2-methyl-6-(2,4,5-trichlorophenyl)pyridin-3-amine (PubChem CID 133086502) has the molecular formula C12H9Cl3N2 and a molecular weight of 287.58 g/mol. Its IUPAC name is 2-methyl-6-(2,4,5-trichlorophenyl)pyridin-3-amine.
| Compound Name | 2-methyl-6-(2,4,5-trichlorophenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133086502 |
| Molecular Formula | C12H9Cl3N2 |
| Molecular Weight | 287.58 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-methyl-6-(2,4,5-trichlorophenyl)pyridin-3-amine |
| SMILES | Cc1nc(-c2cc(Cl)c(Cl)cc2Cl)ccc1N |
| InChI | InChI=1S/C12H9Cl3N2/c1-6-11(16)2-3-12(17-6)7-4-9(14)10(15)5-8(7)13/h2-5H,16H2,1H3 |
| InChIKey | AZXJQLZHXDDOJU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|