C13H9Cl4N — CID 165352055
3-(chloromethyl)-2-methyl-6-(2,4,5-trichlorophenyl)pyridine (PubChem CID 165352055) has the molecular formula C13H9Cl4N and a molecular weight of 321.03 g/mol. Its IUPAC name is 3-(chloromethyl)-2-methyl-6-(2,4,5-trichlorophenyl)pyridine.
| Compound Name | 3-(chloromethyl)-2-methyl-6-(2,4,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 165352055 |
| Molecular Formula | C13H9Cl4N |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 3-(chloromethyl)-2-methyl-6-(2,4,5-trichlorophenyl)pyridine |
| SMILES | Cc1nc(-c2cc(Cl)c(Cl)cc2Cl)ccc1CCl |
| InChI | InChI=1S/C13H9Cl4N/c1-7-8(6-14)2-3-13(18-7)9-4-11(16)12(17)5-10(9)15/h2-5H,6H2,1H3 |
| InChIKey | WEYJQEWWQQBCOQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|