C15H13Cl2NO2 — CID 82452786
3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid (PubChem CID 82452786) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid.
| Compound Name | 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 82452786 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid |
| SMILES | Cc1nc(-c2ccc(Cl)cc2Cl)ccc1CCC(=O)O |
| InChI | InChI=1S/C15H13Cl2NO2/c1-9-10(3-7-15(19)20)2-6-14(18-9)12-5-4-11(16)8-13(12)17/h2,4-6,8H,3,7H2,1H3,(H,19,20) |
| InChIKey | RYIJAXDZXIDLCV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |