3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid

C15H13Cl2NO2 — CID 82452786

IUPAC3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid
SMILESCc1nc(-c2ccc(Cl)cc2Cl)ccc1CCC(=O)O
InChIInChI=1S/C15H13Cl2NO2/c1-9-10(3-7-15(19)20)2-6-14(18-9)12-5-4-11(16)8-13(12)17/h2,4-6,8H,3,7H2,1H3,(H,19,20)
InChIKeyRYIJAXDZXIDLCV-UHFFFAOYSA-N
MW310.18 g/mol
LogP4.38
Rot. Bonds4

About 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid

3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid (PubChem CID 82452786) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid.

Molecular Properties

Compound Name3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid
PubChem CID82452786
Molecular FormulaC15H13Cl2NO2
Molecular Weight310.18 g/mol
Exact Mass309.03
IUPAC Name3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid
SMILESCc1nc(-c2ccc(Cl)cc2Cl)ccc1CCC(=O)O
InChIInChI=1S/C15H13Cl2NO2/c1-9-10(3-7-15(19)20)2-6-14(18-9)12-5-4-11(16)8-13(12)17/h2,4-6,8H,3,7H2,1H3,(H,19,20)
InChIKeyRYIJAXDZXIDLCV-UHFFFAOYSA-N
XLogP4.38
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.18
LogP ≤ 54.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid?
The IUPAC name of 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid (CID 82452786) is 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid.
What is the SMILES notation for 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid?
The canonical SMILES for 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid is Cc1nc(-c2ccc(Cl)cc2Cl)ccc1CCC(=O)O.
What is the InChIKey of 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid?
The InChIKey is RYIJAXDZXIDLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO2/c1-9-10(3-7-15(19)20)2-6-14(18-9)12-5-4-11(16)8-13(12)17/h2,4-6,8H,3,7H2,1H3,(H,19,20).
What are the key properties of 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid?
3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid has a molecular weight of 310.18 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2,4-dichlorophenyl)-2-methyl-3-pyridinyl]propanoic acid is sourced from PubChem (CID 82452786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).