C15H10Cl4O2 — CID 59946858
3-[2,6-dichloro-4-(2,4-dichlorophenyl)phenyl]propanoic acid (PubChem CID 59946858) has the molecular formula C15H10Cl4O2 and a molecular weight of 364.06 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(2,4-dichlorophenyl)phenyl]propanoic acid.
| Compound Name | 3-[2,6-dichloro-4-(2,4-dichlorophenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 59946858 |
| Molecular Formula | C15H10Cl4O2 |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 3-[2,6-dichloro-4-(2,4-dichlorophenyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1c(Cl)cc(-c2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl4O2/c16-9-1-2-10(14(19)7-9)8-5-12(17)11(13(18)6-8)3-4-15(20)21/h1-2,5-7H,3-4H2,(H,20,21) |
| InChIKey | BYTQAQIOCJZQOG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |