C16H14Cl2O4S — CID 11530868
3-[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)phenyl]propanoic acid (PubChem CID 11530868) has the molecular formula C16H14Cl2O4S and a molecular weight of 373.26 g/mol. Its IUPAC name is 3-[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)phenyl]propanoic acid.
| Compound Name | 3-[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 11530868 |
| Molecular Formula | C16H14Cl2O4S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 3-[4-chloro-2-(2-chloro-4-methylsulfonylphenyl)phenyl]propanoic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(Cl)ccc2CCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O4S/c1-23(21,22)12-5-6-13(15(18)9-12)14-8-11(17)4-2-10(14)3-7-16(19)20/h2,4-6,8-9H,3,7H2,1H3,(H,19,20) |
| InChIKey | YHKLYFDOEFAGKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |