About 2,4,6-tris(2,4-dichlorophenyl)pyridine
2,4,6-tris(2,4-dichlorophenyl)pyridine (PubChem CID 86059634) has the molecular formula C23H11Cl6N
and a molecular weight of 514.07 g/mol. Its IUPAC name is 2,4,6-tris(2,4-dichlorophenyl)pyridine.
Molecular Properties
| Compound Name | 2,4,6-tris(2,4-dichlorophenyl)pyridine |
| PubChem CID | 86059634 |
| Molecular Formula | C23H11Cl6N |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 510.90 |
| IUPAC Name | 2,4,6-tris(2,4-dichlorophenyl)pyridine |
| SMILES | Clc1ccc(-c2cc(-c3ccc(Cl)cc3Cl)nc(-c3ccc(Cl)cc3Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H11Cl6N/c24-13-1-4-16(19(27)9-13)12-7-22(17-5-2-14(25)10-20(17)28)30-23(8-12)18-6-3-15(26)11-21(18)29/h1-11H |
| InChIKey | YVHHCWIZXZSNMD-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,6-tris(2,4-dichlorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-tris(2,4-dichlorophenyl)pyridine?
The IUPAC name of 2,4,6-tris(2,4-dichlorophenyl)pyridine (CID 86059634) is 2,4,6-tris(2,4-dichlorophenyl)pyridine.
What is the SMILES notation for 2,4,6-tris(2,4-dichlorophenyl)pyridine?
The canonical SMILES for 2,4,6-tris(2,4-dichlorophenyl)pyridine is Clc1ccc(-c2cc(-c3ccc(Cl)cc3Cl)nc(-c3ccc(Cl)cc3Cl)c2)c(Cl)c1.
What is the InChIKey of 2,4,6-tris(2,4-dichlorophenyl)pyridine?
The InChIKey is YVHHCWIZXZSNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H11Cl6N/c24-13-1-4-16(19(27)9-13)12-7-22(17-5-2-14(25)10-20(17)28)30-23(8-12)18-6-3-15(26)11-21(18)29/h1-11H.
What are the key properties of 2,4,6-tris(2,4-dichlorophenyl)pyridine?
2,4,6-tris(2,4-dichlorophenyl)pyridine has a molecular weight of 514.07 g/mol, XLogP of 10.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-tris(2,4-dichlorophenyl)pyridine is sourced from PubChem (CID 86059634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).