C14H8Cl2O2 — CID 167311958
5-(2,4-dichlorophenyl)benzene-1,3-dicarbaldehyde (PubChem CID 167311958) has the molecular formula C14H8Cl2O2 and a molecular weight of 279.12 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(2,4-dichlorophenyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 167311958 |
| Molecular Formula | C14H8Cl2O2 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 5-(2,4-dichlorophenyl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)cc(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl2O2/c15-12-1-2-13(14(16)6-12)11-4-9(7-17)3-10(5-11)8-18/h1-8H |
| InChIKey | CDIJKVJHKJQBLE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|