C18H14Cl2N2O2 — CID 175922121
2-[2-amino-6-(2,4-dichlorophenyl)-4-pyridinyl]-5-methoxyphenol (PubChem CID 175922121) has the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is 2-[2-amino-6-(2,4-dichlorophenyl)-4-pyridinyl]-5-methoxyphenol.
| Compound Name | 2-[2-amino-6-(2,4-dichlorophenyl)-4-pyridinyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 175922121 |
| Molecular Formula | C18H14Cl2N2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[2-amino-6-(2,4-dichlorophenyl)-4-pyridinyl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2cc(N)nc(-c3ccc(Cl)cc3Cl)c2)c(O)c1 |
| InChI | InChI=1S/C18H14Cl2N2O2/c1-24-12-3-5-13(17(23)9-12)10-6-16(22-18(21)7-10)14-4-2-11(19)8-15(14)20/h2-9,23H,1H3,(H2,21,22) |
| InChIKey | IHYQHTYGZDUGPU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |