C26H22Cl2N2O2 — CID 69347292
[5-(2,4-dichlorophenyl)-2,6-bis(4-methoxyphenyl)-3-pyridinyl]methanamine (PubChem CID 69347292) has the molecular formula C26H22Cl2N2O2 and a molecular weight of 465.38 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)-2,6-bis(4-methoxyphenyl)-3-pyridinyl]methanamine.
| Compound Name | [5-(2,4-dichlorophenyl)-2,6-bis(4-methoxyphenyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 69347292 |
| Molecular Formula | C26H22Cl2N2O2 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [5-(2,4-dichlorophenyl)-2,6-bis(4-methoxyphenyl)-3-pyridinyl]methanamine |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3)c(-c3ccc(Cl)cc3Cl)cc2CN)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O2/c1-31-20-8-3-16(4-9-20)25-18(15-29)13-23(22-12-7-19(27)14-24(22)28)26(30-25)17-5-10-21(32-2)11-6-17/h3-14H,15,29H2,1-2H3 |
| InChIKey | CKXLGNZLXCWMLD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |