C21H20ClFN2O3 — CID 137290858
2-[4-(4-chloro-3-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methoxyphenol (PubChem CID 137290858) has the molecular formula C21H20ClFN2O3 and a molecular weight of 402.85 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methoxyphenol.
| Compound Name | 2-[4-(4-chloro-3-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 137290858 |
| Molecular Formula | C21H20ClFN2O3 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[4-(4-chloro-3-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)c(F)c3)cc(NCCCO)n2)c(O)c1 |
| InChI | InChI=1S/C21H20ClFN2O3/c1-28-15-4-5-16(20(27)12-15)19-10-14(11-21(25-19)24-7-2-8-26)13-3-6-17(22)18(23)9-13/h3-6,9-12,26-27H,2,7-8H2,1H3,(H,24,25) |
| InChIKey | MSEWQJJYDFCOGY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|